C27H46N2O2 — CID 54672718
(1S,2R,8R,9E,11S,12S,15R,16R)-9-hydroxyimino-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-6-azatetracyclo[9.7.0.02,8.012,16]octadecan-5-one (PubChem CID 54672718) has the molecular formula C27H46N2O2 and a molecular weight of 430.68 g/mol. Its IUPAC name is (1S,2R,8R,9E,11S,12S,15R,16R)-9-hydroxyimino-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-6-azatetracyclo[9.7.0.02,8.012,16]octadecan-5-one.
| Compound Name | (1S,2R,8R,9E,11S,12S,15R,16R)-9-hydroxyimino-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-6-azatetracyclo[9.7.0.02,8.012,16]octadecan-5-one |
|---|---|
| PubChem CID | 54672718 |
| Molecular Formula | C27H46N2O2 |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 430.36 |
| IUPAC Name | (1S,2R,8R,9E,11S,12S,15R,16R)-9-hydroxyimino-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-6-azatetracyclo[9.7.0.02,8.012,16]octadecan-5-one |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C/C(=N\O)[C@H]4CNC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H46N2O2/c1-17(2)7-6-8-18(3)20-9-10-21-19-15-24(29-31)23-16-28-25(30)12-14-27(23,5)22(19)11-13-26(20,21)4/h17-23,31H,6-16H2,1-5H3,(H,28,30)/b29-24+/t18-,19+,20-,21+,22+,23-,26-,27-/m1/s1 |
| InChIKey | DXFNZZDAWQAWST-IYPGVLJOSA-N |
| XLogP | 6.27 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|