C17H31NO2 — CID 11500133
(3aR,4S,7aS)-7a-[(E)-hydroxyiminomethyl]-1-(5-methylhexyl)-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 11500133) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is (3aR,4S,7aS)-7a-[(E)-hydroxyiminomethyl]-1-(5-methylhexyl)-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | (3aR,4S,7aS)-7a-[(E)-hydroxyiminomethyl]-1-(5-methylhexyl)-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 11500133 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | (3aR,4S,7aS)-7a-[(E)-hydroxyiminomethyl]-1-(5-methylhexyl)-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | CC(C)CCCCC1CC[C@H]2[C@@H](O)CCC[C@]12/C=N/O |
| InChI | InChI=1S/C17H31NO2/c1-13(2)6-3-4-7-14-9-10-15-16(19)8-5-11-17(14,15)12-18-20/h12-16,19-20H,3-11H2,1-2H3/b18-12+/t14?,15-,16-,17-/m0/s1 |
| InChIKey | JPIWQQAAQFDPIQ-AXNLDNSJSA-N |
| XLogP | 4.22 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|