C26H42O2 — CID 143014798
(3S,10R,13R,17S)-3-hydroxy-10,13-dimethyl-17-(5-methylhexyl)-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one (PubChem CID 143014798) has the molecular formula C26H42O2 and a molecular weight of 386.62 g/mol. Its IUPAC name is (3S,10R,13R,17S)-3-hydroxy-10,13-dimethyl-17-(5-methylhexyl)-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one.
| Compound Name | (3S,10R,13R,17S)-3-hydroxy-10,13-dimethyl-17-(5-methylhexyl)-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one |
|---|---|
| PubChem CID | 143014798 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | (3S,10R,13R,17S)-3-hydroxy-10,13-dimethyl-17-(5-methylhexyl)-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one |
| SMILES | CC(C)CCCC[C@H]1CCC2C3C(=O)C=C4C[C@@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C26H42O2/c1-17(2)7-5-6-8-18-9-10-21-24-22(12-14-25(18,21)3)26(4)13-11-20(27)15-19(26)16-23(24)28/h16-18,20-22,24,27H,5-15H2,1-4H3/t18-,20-,21?,22?,24?,25+,26-/m0/s1 |
| InChIKey | HZUZZGMASKMSOZ-OPOKUARNSA-N |
| XLogP | 6.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|