C27H44AcO2 — CID 59884221
actinium;(10R,13R,17R)-3-hydroxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one (PubChem CID 59884221) has the molecular formula C27H44AcO2 and a molecular weight of 627.65 g/mol. Its IUPAC name is actinium;(10R,13R,17R)-3-hydroxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one.
| Compound Name | actinium;(10R,13R,17R)-3-hydroxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one |
|---|---|
| PubChem CID | 59884221 |
| Molecular Formula | C27H44AcO2 |
| Molecular Weight | 627.65 g/mol |
| Exact Mass | 627.36 |
| IUPAC Name | actinium;(10R,13R,17R)-3-hydroxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one |
| SMILES | CC(C)CCCC(C)[C@H]1CCC2C3C(=O)C=C4CC(O)CC[C@]4(C)C3CC[C@@]21C.[Ac] |
| InChI | InChI=1S/C27H44O2.Ac/c1-17(2)7-6-8-18(3)21-9-10-22-25-23(12-14-27(21,22)5)26(4)13-11-20(28)15-19(26)16-24(25)29;/h16-18,20-23,25,28H,6-15H2,1-5H3;/t18?,20?,21-,22?,23?,25?,26+,27-;/m1./s1 |
| InChIKey | YUXHDKZMGJYMBR-WPYCEHDGSA-N |
| XLogP | 6.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.65 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |