C27H46N2O — CID 11820981
(3S,7Z,10R,13R,14S,17R)-7-hydrazinylidene-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 11820981) has the molecular formula C27H46N2O and a molecular weight of 414.68 g/mol. Its IUPAC name is (3S,7Z,10R,13R,14S,17R)-7-hydrazinylidene-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,7Z,10R,13R,14S,17R)-7-hydrazinylidene-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 11820981 |
| Molecular Formula | C27H46N2O |
| Molecular Weight | 414.68 g/mol |
| Exact Mass | 414.36 |
| IUPAC Name | (3S,7Z,10R,13R,14S,17R)-7-hydrazinylidene-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2C3/C(=N/N)C=C4C[C@@H](O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C27H46N2O/c1-17(2)7-6-8-18(3)21-9-10-22-25-23(12-14-27(21,22)5)26(4)13-11-20(30)15-19(26)16-24(25)29-28/h16-18,20-23,25,30H,6-15,28H2,1-5H3/b29-24+/t18-,20+,21-,22+,23?,25?,26+,27-/m1/s1 |
| InChIKey | GVYXSGWFKBPUTK-MMUJCHSSSA-N |
| XLogP | 6.31 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.68 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|