C30H52O3SSi — CID 101088606
[(6S)-6-[(1S,3aS,4S,7aS)-4-(benzenesulfonyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methylheptan-2-yl]oxy-triethylsilane (PubChem CID 101088606) has the molecular formula C30H52O3SSi and a molecular weight of 520.90 g/mol. Its IUPAC name is [(6S)-6-[(1S,3aS,4S,7aS)-4-(benzenesulfonyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methylheptan-2-yl]oxy-triethylsilane.
| Compound Name | [(6S)-6-[(1S,3aS,4S,7aS)-4-(benzenesulfonyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methylheptan-2-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 101088606 |
| Molecular Formula | C30H52O3SSi |
| Molecular Weight | 520.90 g/mol |
| Exact Mass | 520.34 |
| IUPAC Name | [(6S)-6-[(1S,3aS,4S,7aS)-4-(benzenesulfonyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methylheptan-2-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC(C)(C)CCC[C@H](C)[C@@H]1CC[C@@H]2[C@@H](S(=O)(=O)c3ccccc3)CCC[C@]21C |
| InChI | InChI=1S/C30H52O3SSi/c1-8-35(9-2,10-3)33-29(5,6)22-14-16-24(4)26-20-21-27-28(19-15-23-30(26,27)7)34(31,32)25-17-12-11-13-18-25/h11-13,17-18,24,26-28H,8-10,14-16,19-23H2,1-7H3/t24-,26-,27+,28-,30-/m0/s1 |
| InChIKey | KXFQPLSEFPGNRC-MDOFJTOVSA-N |
| XLogP | 8.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.90 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|