C31H44O3S — CID 10696612
(1R,3aR,4R,7aR)-4-(benzenesulfonyl)-7a-methyl-1-[(2R)-6-methyl-6-phenylmethoxyheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroindene (PubChem CID 10696612) has the molecular formula C31H44O3S and a molecular weight of 496.76 g/mol. Its IUPAC name is (1R,3aR,4R,7aR)-4-(benzenesulfonyl)-7a-methyl-1-[(2R)-6-methyl-6-phenylmethoxyheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroindene.
| Compound Name | (1R,3aR,4R,7aR)-4-(benzenesulfonyl)-7a-methyl-1-[(2R)-6-methyl-6-phenylmethoxyheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroindene |
|---|---|
| PubChem CID | 10696612 |
| Molecular Formula | C31H44O3S |
| Molecular Weight | 496.76 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | (1R,3aR,4R,7aR)-4-(benzenesulfonyl)-7a-methyl-1-[(2R)-6-methyl-6-phenylmethoxyheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroindene |
| SMILES | C[C@H](CCCC(C)(C)OCc1ccccc1)[C@H]1CC[C@H]2[C@H](S(=O)(=O)c3ccccc3)CCC[C@]12C |
| InChI | InChI=1S/C31H44O3S/c1-24(13-11-21-30(2,3)34-23-25-14-7-5-8-15-25)27-19-20-28-29(18-12-22-31(27,28)4)35(32,33)26-16-9-6-10-17-26/h5-10,14-17,24,27-29H,11-13,18-23H2,1-4H3/t24-,27-,28+,29-,31-/m1/s1 |
| InChIKey | BXALHURXDHLIKD-VEZAKBLNSA-N |
| XLogP | 7.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.76 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |