C21H32O4S — CID 162761261
[(3R)-3-[(1R,4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]butyl] 4-methylbenzenesulfonate (PubChem CID 162761261) has the molecular formula C21H32O4S and a molecular weight of 380.55 g/mol. Its IUPAC name is [(3R)-3-[(1R,4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]butyl] 4-methylbenzenesulfonate.
| Compound Name | [(3R)-3-[(1R,4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]butyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 162761261 |
| Molecular Formula | C21H32O4S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | [(3R)-3-[(1R,4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]butyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC[C@@H](C)[C@H]2CCC3[C@@H](O)CCC[C@@]32C)cc1 |
| InChI | InChI=1S/C21H32O4S/c1-15-6-8-17(9-7-15)26(23,24)25-14-12-16(2)18-10-11-19-20(22)5-4-13-21(18,19)3/h6-9,16,18-20,22H,4-5,10-14H2,1-3H3/t16-,18-,19?,20+,21-/m1/s1 |
| InChIKey | RDDLTHKITQGIIA-BKKMZRRASA-N |
| XLogP | 4.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|