C32H46O5S — CID 169103260
[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-4-(4-methylphenyl)sulfonyloxybutan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 169103260) has the molecular formula C32H46O5S and a molecular weight of 542.78 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-4-(4-methylphenyl)sulfonyloxybutan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-4-(4-methylphenyl)sulfonyloxybutan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 169103260 |
| Molecular Formula | C32H46O5S |
| Molecular Weight | 542.78 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-4-(4-methylphenyl)sulfonyloxybutan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCOS(=O)(=O)c5ccc(C)cc5)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C32H46O5S/c1-21-6-9-26(10-7-21)38(34,35)36-19-16-22(2)28-12-13-29-27-11-8-24-20-25(37-23(3)33)14-17-31(24,4)30(27)15-18-32(28,29)5/h6-10,22,25,27-30H,11-20H2,1-5H3/t22-,25+,27+,28-,29+,30+,31+,32-/m1/s1 |
| InChIKey | HHFBSIKQKOEWMC-SKSJFTFLSA-N |
| XLogP | 7.24 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.78 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|