C36H54O4S — CID 67865745
[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methyl-7-(4-methylphenyl)sulfonylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 67865745) has the molecular formula C36H54O4S and a molecular weight of 582.89 g/mol. Its IUPAC name is [(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methyl-7-(4-methylphenyl)sulfonylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methyl-7-(4-methylphenyl)sulfonylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 67865745 |
| Molecular Formula | C36H54O4S |
| Molecular Weight | 582.89 g/mol |
| Exact Mass | 582.37 |
| IUPAC Name | [(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methyl-7-(4-methylphenyl)sulfonylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCC(C)CS(=O)(=O)c5ccc(C)cc5)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C36H54O4S/c1-24-10-13-30(14-11-24)41(38,39)23-25(2)8-7-9-26(3)32-16-17-33-31-15-12-28-22-29(40-27(4)37)18-20-35(28,5)34(31)19-21-36(32,33)6/h10-14,25-26,29,31-34H,7-9,15-23H2,1-6H3/t25?,26-,29-,31+,32-,33+,34+,35+,36-/m1/s1 |
| InChIKey | GAVRSPKLAGBXIY-PVLDKFSSSA-N |
| XLogP | 8.72 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.89 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|