C31H50O4 — CID 634645
[6-(3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylheptyl] acetate (PubChem CID 634645) has the molecular formula C31H50O4 and a molecular weight of 486.74 g/mol. Its IUPAC name is [6-(3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylheptyl] acetate.
| Compound Name | [6-(3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylheptyl] acetate |
|---|---|
| PubChem CID | 634645 |
| Molecular Formula | C31H50O4 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | [6-(3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylheptyl] acetate |
| SMILES | CC(=O)OCC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(C)=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C31H50O4/c1-20(19-34-22(3)32)8-7-9-21(2)27-12-13-28-26-11-10-24-18-25(35-23(4)33)14-16-30(24,5)29(26)15-17-31(27,28)6/h10,20-21,25-29H,7-9,11-19H2,1-6H3 |
| InChIKey | BHIIFKXBBYKZCA-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|