C32H48O5S — CID 22210462
(4R)-4-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3-[(4-methylphenyl)sulfonyloxymethyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 22210462) has the molecular formula C32H48O5S and a molecular weight of 544.80 g/mol. Its IUPAC name is (4R)-4-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3-[(4-methylphenyl)sulfonyloxymethyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3-[(4-methylphenyl)sulfonyloxymethyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 22210462 |
| Molecular Formula | C32H48O5S |
| Molecular Weight | 544.80 g/mol |
| Exact Mass | 544.32 |
| IUPAC Name | (4R)-4-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3-[(4-methylphenyl)sulfonyloxymethyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CC[C@@]3(C)C(CC[C@H]4[C@@H]5CC[C@H]([C@H](C)CCC(=O)O)[C@@]5(C)CC[C@@H]43)C2)cc1 |
| InChI | InChI=1S/C32H48O5S/c1-21-5-9-25(10-6-21)38(35,36)37-20-23-15-17-31(3)24(19-23)8-11-26-28-13-12-27(22(2)7-14-30(33)34)32(28,4)18-16-29(26)31/h5-6,9-10,22-24,26-29H,7-8,11-20H2,1-4H3,(H,33,34)/t22-,23?,24?,26+,27-,28+,29+,31+,32-/m1/s1 |
| InChIKey | RMRBCXOSTWQMMF-OPYNTMHLSA-N |
| XLogP | 7.48 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.80 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|