C34H52O5S — CID 620570
[10,13-dimethyl-17-[5-(4-methylphenyl)sulfonyloxyhexan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 620570) has the molecular formula C34H52O5S and a molecular weight of 572.85 g/mol. Its IUPAC name is [10,13-dimethyl-17-[5-(4-methylphenyl)sulfonyloxyhexan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [10,13-dimethyl-17-[5-(4-methylphenyl)sulfonyloxyhexan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 620570 |
| Molecular Formula | C34H52O5S |
| Molecular Weight | 572.85 g/mol |
| Exact Mass | 572.35 |
| IUPAC Name | [10,13-dimethyl-17-[5-(4-methylphenyl)sulfonyloxyhexan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C)C(CCC3C2CCC2(C)C(C(C)CCC(C)OS(=O)(=O)c4ccc(C)cc4)CCC32)C1 |
| InChI | InChI=1S/C34H52O5S/c1-22-7-12-28(13-8-22)40(36,37)39-24(3)10-9-23(2)30-15-16-31-29-14-11-26-21-27(38-25(4)35)17-19-33(26,5)32(29)18-20-34(30,31)6/h7-8,12-13,23-24,26-27,29-32H,9-11,14-21H2,1-6H3 |
| InChIKey | RFYQTEWZQLAGPT-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.85 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|