C30H44O5S — CID 57373523
[(8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-[1-(4-methylphenyl)sulfonyloxyethyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 57373523) has the molecular formula C30H44O5S and a molecular weight of 516.74 g/mol. Its IUPAC name is [(8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-[1-(4-methylphenyl)sulfonyloxyethyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-[1-(4-methylphenyl)sulfonyloxyethyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 57373523 |
| Molecular Formula | C30H44O5S |
| Molecular Weight | 516.74 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | [(8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-[1-(4-methylphenyl)sulfonyloxyethyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CC[C@@]2(C)C(CC[C@H]3[C@@H]4CC[C@H](C(C)OS(=O)(=O)c5ccc(C)cc5)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C30H44O5S/c1-19-6-9-24(10-7-19)36(32,33)35-20(2)26-12-13-27-25-11-8-22-18-23(34-21(3)31)14-16-29(22,4)28(25)15-17-30(26,27)5/h6-7,9-10,20,22-23,25-28H,8,11-18H2,1-5H3/t20?,22?,23?,25-,26+,27-,28-,29-,30+/m0/s1 |
| InChIKey | XANCCOFHPDYKLX-NMFKGQOMSA-N |
| XLogP | 6.68 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.74 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|