C34H44O5S — CID 101007001
[(1R)-1-[(3S,3aS,5aS,5bS,8S,9aS,10aR,10bS)-3a,5b-dimethyl-8-(4-methylphenyl)sulfonyloxy-1,2,3,4,5,5a,6,7,8,9,9a,10,10a,10b-tetradecahydrocyclopenta[a]fluoren-3-yl]ethyl] benzoate (PubChem CID 101007001) has the molecular formula C34H44O5S and a molecular weight of 564.79 g/mol. Its IUPAC name is [(1R)-1-[(3S,3aS,5aS,5bS,8S,9aS,10aR,10bS)-3a,5b-dimethyl-8-(4-methylphenyl)sulfonyloxy-1,2,3,4,5,5a,6,7,8,9,9a,10,10a,10b-tetradecahydrocyclopenta[a]fluoren-3-yl]ethyl] benzoate.
| Compound Name | [(1R)-1-[(3S,3aS,5aS,5bS,8S,9aS,10aR,10bS)-3a,5b-dimethyl-8-(4-methylphenyl)sulfonyloxy-1,2,3,4,5,5a,6,7,8,9,9a,10,10a,10b-tetradecahydrocyclopenta[a]fluoren-3-yl]ethyl] benzoate |
|---|---|
| PubChem CID | 101007001 |
| Molecular Formula | C34H44O5S |
| Molecular Weight | 564.79 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | [(1R)-1-[(3S,3aS,5aS,5bS,8S,9aS,10aR,10bS)-3a,5b-dimethyl-8-(4-methylphenyl)sulfonyloxy-1,2,3,4,5,5a,6,7,8,9,9a,10,10a,10b-tetradecahydrocyclopenta[a]fluoren-3-yl]ethyl] benzoate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2CC[C@@]3(C)[C@H](C2)C[C@@H]2[C@@H]3CC[C@]3(C)[C@@H]([C@@H](C)OC(=O)c4ccccc4)CC[C@@H]23)cc1 |
| InChI | InChI=1S/C34H44O5S/c1-22-10-12-27(13-11-22)40(36,37)39-26-16-18-33(3)25(20-26)21-28-30-15-14-29(34(30,4)19-17-31(28)33)23(2)38-32(35)24-8-6-5-7-9-24/h5-13,23,25-26,28-31H,14-21H2,1-4H3/t23-,25-,26+,28+,29-,30+,31+,33+,34-/m1/s1 |
| InChIKey | SZVUBZAPUKQRSL-RLXKUHFDSA-N |
| XLogP | 7.58 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.79 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|