C25H42O2 — CID 126492933
4-[(3R,5R,10S,13R,17R)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 126492933) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is 4-[(3R,5R,10S,13R,17R)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | 4-[(3R,5R,10S,13R,17R)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 126492933 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | 4-[(3R,5R,10S,13R,17R)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | CC(CCC(=O)O)[C@H]1CCC2C3CC[C@@H]4C[C@H](C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C25H42O2/c1-16-11-13-24(3)18(15-16)6-7-19-21-9-8-20(17(2)5-10-23(26)27)25(21,4)14-12-22(19)24/h16-22H,5-15H2,1-4H3,(H,26,27)/t16-,17?,18-,19?,20-,21?,22?,24+,25-/m1/s1 |
| InChIKey | XTJCTCUXMIAKLW-YPMRGKMHSA-N |
| XLogP | 6.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |