C25H43NO — CID 20683777
4-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanamide (PubChem CID 20683777) has the molecular formula C25H43NO and a molecular weight of 373.63 g/mol. Its IUPAC name is 4-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanamide.
| Compound Name | 4-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanamide |
|---|---|
| PubChem CID | 20683777 |
| Molecular Formula | C25H43NO |
| Molecular Weight | 373.63 g/mol |
| Exact Mass | 373.33 |
| IUPAC Name | 4-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanamide |
| SMILES | CC1CCC2(C)C(CCC3C2CCC2(C)C(C(C)CCC(N)=O)CCC32)C1 |
| InChI | InChI=1S/C25H43NO/c1-16-11-13-24(3)18(15-16)6-7-19-21-9-8-20(17(2)5-10-23(26)27)25(21,4)14-12-22(19)24/h16-22H,5-15H2,1-4H3,(H2,26,27) |
| InChIKey | YSHFHJXNLMXCKJ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.63 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |