C25H44O3 — CID 145166576
methanol;3-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanoic acid (PubChem CID 145166576) has the molecular formula C25H44O3 and a molecular weight of 392.62 g/mol. Its IUPAC name is methanol;3-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanoic acid.
| Compound Name | methanol;3-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanoic acid |
|---|---|
| PubChem CID | 145166576 |
| Molecular Formula | C25H44O3 |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 392.33 |
| IUPAC Name | methanol;3-(3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanoic acid |
| SMILES | CC1CCC2(C)C(CCC3C2CCC2(C)C(C(C)CC(=O)O)CCC32)C1.CO |
| InChI | InChI=1S/C24H40O2.CH4O/c1-15-9-11-23(3)17(13-15)5-6-18-20-8-7-19(16(2)14-22(25)26)24(20,4)12-10-21(18)23;1-2/h15-21H,5-14H2,1-4H3,(H,25,26);2H,1H3 |
| InChIKey | QKACENHTPNDFFP-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |