C20H29IO — CID 133268447
(1S,4R,7aS)-1-[(2R)-1-iodopropan-2-yl]-7a-methyl-4-phenylmethoxy-1,2,3,3a,4,5,6,7-octahydroindene (PubChem CID 133268447) has the molecular formula C20H29IO and a molecular weight of 412.36 g/mol. Its IUPAC name is (1S,4R,7aS)-1-[(2R)-1-iodopropan-2-yl]-7a-methyl-4-phenylmethoxy-1,2,3,3a,4,5,6,7-octahydroindene.
| Compound Name | (1S,4R,7aS)-1-[(2R)-1-iodopropan-2-yl]-7a-methyl-4-phenylmethoxy-1,2,3,3a,4,5,6,7-octahydroindene |
|---|---|
| PubChem CID | 133268447 |
| Molecular Formula | C20H29IO |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | (1S,4R,7aS)-1-[(2R)-1-iodopropan-2-yl]-7a-methyl-4-phenylmethoxy-1,2,3,3a,4,5,6,7-octahydroindene |
| SMILES | C[C@@H](CI)[C@@H]1CCC2[C@H](OCc3ccccc3)CCC[C@]21C |
| InChI | InChI=1S/C20H29IO/c1-15(13-21)17-10-11-18-19(9-6-12-20(17,18)2)22-14-16-7-4-3-5-8-16/h3-5,7-8,15,17-19H,6,9-14H2,1-2H3/t15-,17-,18?,19+,20-/m0/s1 |
| InChIKey | RZSSGHBWFWDOMC-GGUHUXNSSA-N |
| XLogP | 5.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|