C28H46O2Si — CID 10972276
(4S,6R)-6-[(4S,7aR)-7a-methyl-4-phenylmethoxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methyl-4-trimethylsilylhept-1-en-4-ol (PubChem CID 10972276) has the molecular formula C28H46O2Si and a molecular weight of 442.76 g/mol. Its IUPAC name is (4S,6R)-6-[(4S,7aR)-7a-methyl-4-phenylmethoxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methyl-4-trimethylsilylhept-1-en-4-ol.
| Compound Name | (4S,6R)-6-[(4S,7aR)-7a-methyl-4-phenylmethoxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methyl-4-trimethylsilylhept-1-en-4-ol |
|---|---|
| PubChem CID | 10972276 |
| Molecular Formula | C28H46O2Si |
| Molecular Weight | 442.76 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | (4S,6R)-6-[(4S,7aR)-7a-methyl-4-phenylmethoxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-methyl-4-trimethylsilylhept-1-en-4-ol |
| SMILES | C=C(C)C[C@](O)(C[C@@H](C)C1CCC2[C@@H](OCc3ccccc3)CCC[C@]12C)[Si](C)(C)C |
| InChI | InChI=1S/C28H46O2Si/c1-21(2)18-28(29,31(5,6)7)19-22(3)24-15-16-25-26(14-11-17-27(24,25)4)30-20-23-12-9-8-10-13-23/h8-10,12-13,22,24-26,29H,1,11,14-20H2,2-7H3/t22-,24?,25?,26+,27-,28-/m1/s1 |
| InChIKey | MFLACAFJNJRPAF-MIZVKNADSA-N |
| XLogP | 7.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.76 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|