C20H28O2 — CID 135011125
(1aS,3aR,4R,6aR,6bR)-3a-methyl-4-[(2S)-1-phenylmethoxypropan-2-yl]-1a,2,3,4,5,6,6a,6b-octahydroindeno[4,5-b]oxirene (PubChem CID 135011125) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (1aS,3aR,4R,6aR,6bR)-3a-methyl-4-[(2S)-1-phenylmethoxypropan-2-yl]-1a,2,3,4,5,6,6a,6b-octahydroindeno[4,5-b]oxirene.
| Compound Name | (1aS,3aR,4R,6aR,6bR)-3a-methyl-4-[(2S)-1-phenylmethoxypropan-2-yl]-1a,2,3,4,5,6,6a,6b-octahydroindeno[4,5-b]oxirene |
|---|---|
| PubChem CID | 135011125 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (1aS,3aR,4R,6aR,6bR)-3a-methyl-4-[(2S)-1-phenylmethoxypropan-2-yl]-1a,2,3,4,5,6,6a,6b-octahydroindeno[4,5-b]oxirene |
| SMILES | C[C@H](COCc1ccccc1)[C@H]1CC[C@H]2[C@H]3O[C@H]3CC[C@]12C |
| InChI | InChI=1S/C20H28O2/c1-14(12-21-13-15-6-4-3-5-7-15)16-8-9-17-19-18(22-19)10-11-20(16,17)2/h3-7,14,16-19H,8-13H2,1-2H3/t14-,16-,17+,18+,19-,20-/m1/s1 |
| InChIKey | IKFLQYBAGFPVNS-UNLOAFCFSA-N |
| XLogP | 4.43 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|