C24H32O4 — CID 11111788
(2S,3S)-3-methyl-4-phenylmethoxy-1-[(2R,3S)-3-[(2S)-1-phenylmethoxypropan-2-yl]oxiran-2-yl]butan-2-ol (PubChem CID 11111788) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is (2S,3S)-3-methyl-4-phenylmethoxy-1-[(2R,3S)-3-[(2S)-1-phenylmethoxypropan-2-yl]oxiran-2-yl]butan-2-ol.
| Compound Name | (2S,3S)-3-methyl-4-phenylmethoxy-1-[(2R,3S)-3-[(2S)-1-phenylmethoxypropan-2-yl]oxiran-2-yl]butan-2-ol |
|---|---|
| PubChem CID | 11111788 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (2S,3S)-3-methyl-4-phenylmethoxy-1-[(2R,3S)-3-[(2S)-1-phenylmethoxypropan-2-yl]oxiran-2-yl]butan-2-ol |
| SMILES | C[C@@H](COCc1ccccc1)[C@@H]1O[C@@H]1C[C@H](O)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C24H32O4/c1-18(14-26-16-20-9-5-3-6-10-20)22(25)13-23-24(28-23)19(2)15-27-17-21-11-7-4-8-12-21/h3-12,18-19,22-25H,13-17H2,1-2H3/t18-,19-,22-,23+,24-/m0/s1 |
| InChIKey | JSLDXVWSXUHLIY-KKXZWXNMSA-N |
| XLogP | 4.21 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|