C25H45F3O4SSi — CID 89472765
[(7aR)-7a-methyl-1-[(2R)-6-methyl-6-triethylsilyloxyheptan-2-yl]-1,2,3,3a,6,7-hexahydroinden-4-yl] trifluoromethanesulfonate (PubChem CID 89472765) has the molecular formula C25H45F3O4SSi and a molecular weight of 526.78 g/mol. Its IUPAC name is [(7aR)-7a-methyl-1-[(2R)-6-methyl-6-triethylsilyloxyheptan-2-yl]-1,2,3,3a,6,7-hexahydroinden-4-yl] trifluoromethanesulfonate.
| Compound Name | [(7aR)-7a-methyl-1-[(2R)-6-methyl-6-triethylsilyloxyheptan-2-yl]-1,2,3,3a,6,7-hexahydroinden-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89472765 |
| Molecular Formula | C25H45F3O4SSi |
| Molecular Weight | 526.78 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | [(7aR)-7a-methyl-1-[(2R)-6-methyl-6-triethylsilyloxyheptan-2-yl]-1,2,3,3a,6,7-hexahydroinden-4-yl] trifluoromethanesulfonate |
| SMILES | CC[Si](CC)(CC)OC(C)(C)CCC[C@@H](C)C1CCC2C(OS(=O)(=O)C(F)(F)F)=CCC[C@@]21C |
| InChI | InChI=1S/C25H45F3O4SSi/c1-8-34(9-2,10-3)32-23(5,6)17-11-13-19(4)20-15-16-21-22(14-12-18-24(20,21)7)31-33(29,30)25(26,27)28/h14,19-21H,8-13,15-18H2,1-7H3/t19-,20?,21?,24-/m1/s1 |
| InChIKey | AMIODILFRZDIIO-UXVTZTSVSA-N |
| XLogP | 8.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.78 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|