C15H25F3O4S — CID 142088894
ethane;[1-(2-hydroxyethyl)-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl] trifluoromethanesulfonate (PubChem CID 142088894) has the molecular formula C15H25F3O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is ethane;[1-(2-hydroxyethyl)-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl] trifluoromethanesulfonate.
| Compound Name | ethane;[1-(2-hydroxyethyl)-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 142088894 |
| Molecular Formula | C15H25F3O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | ethane;[1-(2-hydroxyethyl)-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl] trifluoromethanesulfonate |
| SMILES | CC.CC12CCC=C(OS(=O)(=O)C(F)(F)F)C1CCC2CCO |
| InChI | InChI=1S/C13H19F3O4S.C2H6/c1-12-7-2-3-11(20-21(18,19)13(14,15)16)10(12)5-4-9(12)6-8-17;1-2/h3,9-10,17H,2,4-8H2,1H3;1-2H3 |
| InChIKey | CEVCLHRSYHSTEX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|