C20H33F3O3S — CID 59054934
[(1R,3aR,7aR)-1-[(2R)-6,6-dimethylheptan-2-yl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl] trifluoromethanesulfonate (PubChem CID 59054934) has the molecular formula C20H33F3O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is [(1R,3aR,7aR)-1-[(2R)-6,6-dimethylheptan-2-yl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl] trifluoromethanesulfonate.
| Compound Name | [(1R,3aR,7aR)-1-[(2R)-6,6-dimethylheptan-2-yl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59054934 |
| Molecular Formula | C20H33F3O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | [(1R,3aR,7aR)-1-[(2R)-6,6-dimethylheptan-2-yl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl] trifluoromethanesulfonate |
| SMILES | C[C@H](CCCC(C)(C)C)[C@H]1CC[C@H]2C(OS(=O)(=O)C(F)(F)F)=CCC[C@]12C |
| InChI | InChI=1S/C20H33F3O3S/c1-14(8-6-12-18(2,3)4)15-10-11-16-17(9-7-13-19(15,16)5)26-27(24,25)20(21,22)23/h9,14-16H,6-8,10-13H2,1-5H3/t14-,15-,16+,19-/m1/s1 |
| InChIKey | PWWXEUWXAFLAOP-OAFZBRQQSA-N |
| XLogP | 6.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|