C18H31Br — CID 11566075
(1R,3aR,7aR)-4-bromo-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,6,7-hexahydroindene (PubChem CID 11566075) has the molecular formula C18H31Br and a molecular weight of 327.35 g/mol. Its IUPAC name is (1R,3aR,7aR)-4-bromo-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,6,7-hexahydroindene.
| Compound Name | (1R,3aR,7aR)-4-bromo-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,6,7-hexahydroindene |
|---|---|
| PubChem CID | 11566075 |
| Molecular Formula | C18H31Br |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (1R,3aR,7aR)-4-bromo-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,6,7-hexahydroindene |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2C(Br)=CCC[C@]12C |
| InChI | InChI=1S/C18H31Br/c1-13(2)7-5-8-14(3)15-10-11-16-17(19)9-6-12-18(15,16)4/h9,13-16H,5-8,10-12H2,1-4H3/t14-,15-,16+,18-/m1/s1 |
| InChIKey | CJKCYBUNWUEBRO-XLMAVXFVSA-N |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |