C29H50 — CID 173263956
(4R,5S,9R,10S,13R,14R,17R)-4-ethyl-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 173263956) has the molecular formula C29H50 and a molecular weight of 398.72 g/mol. Its IUPAC name is (4R,5S,9R,10S,13R,14R,17R)-4-ethyl-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (4R,5S,9R,10S,13R,14R,17R)-4-ethyl-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 173263956 |
| Molecular Formula | C29H50 |
| Molecular Weight | 398.72 g/mol |
| Exact Mass | 398.39 |
| IUPAC Name | (4R,5S,9R,10S,13R,14R,17R)-4-ethyl-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC[C@@H]1CCC[C@]2(C)[C@H]3CC[C@]4(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@H]4C3=CC[C@@H]12 |
| InChI | InChI=1S/C29H50/c1-7-22-12-9-18-28(5)25(22)14-13-23-26-16-15-24(21(4)11-8-10-20(2)3)29(26,6)19-17-27(23)28/h13,20-22,24-27H,7-12,14-19H2,1-6H3/t21-,22-,24-,25+,26+,27+,28+,29-/m1/s1 |
| InChIKey | IVZXZBNONJKPGL-GZXJXQKYSA-N |
| XLogP | 9.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.72 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|