C28H45N — CID 70182476
(5R,9S,10R,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-5-carbonitrile (PubChem CID 70182476) has the molecular formula C28H45N and a molecular weight of 395.68 g/mol. Its IUPAC name is (5R,9S,10R,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-5-carbonitrile.
| Compound Name | (5R,9S,10R,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-5-carbonitrile |
|---|---|
| PubChem CID | 70182476 |
| Molecular Formula | C28H45N |
| Molecular Weight | 395.68 g/mol |
| Exact Mass | 395.36 |
| IUPAC Name | (5R,9S,10R,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-5-carbonitrile |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2C3=CC[C@]4(C#N)CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H45N/c1-20(2)9-8-10-21(3)23-11-12-24-22-13-18-28(19-29)16-7-6-15-27(28,5)25(22)14-17-26(23,24)4/h13,20-21,23-25H,6-12,14-18H2,1-5H3/t21-,23-,24+,25+,26-,27-,28+/m1/s1 |
| InChIKey | MYPPCURLCUEDQY-QNFGJQKUSA-N |
| XLogP | 8.31 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.68 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|