C28H43NO — CID 69412903
(5R,9S,10R,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-oxo-2,4,6,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-5-carbonitrile (PubChem CID 69412903) has the molecular formula C28H43NO and a molecular weight of 409.66 g/mol. Its IUPAC name is (5R,9S,10R,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-oxo-2,4,6,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-5-carbonitrile.
| Compound Name | (5R,9S,10R,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-oxo-2,4,6,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-5-carbonitrile |
|---|---|
| PubChem CID | 69412903 |
| Molecular Formula | C28H43NO |
| Molecular Weight | 409.66 g/mol |
| Exact Mass | 409.33 |
| IUPAC Name | (5R,9S,10R,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-3-oxo-2,4,6,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-5-carbonitrile |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2C3=CC[C@@]4(C#N)CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H43NO/c1-19(2)7-6-8-20(3)23-9-10-24-22-12-16-28(18-29)17-21(30)11-15-27(28,5)25(22)13-14-26(23,24)4/h12,19-20,23-25H,6-11,13-17H2,1-5H3/t20-,23-,24+,25+,26-,27-,28+/m1/s1 |
| InChIKey | XOEGYTNJHGDHON-NPAYZTOISA-N |
| XLogP | 7.49 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.66 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|