C30H48O3Si — CID 59142183
[(1R,3aR,4S,7aR)-1-[(E,2R,6R)-6-[tert-butyl(dimethyl)silyl]oxyhept-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] benzoate (PubChem CID 59142183) has the molecular formula C30H48O3Si and a molecular weight of 484.80 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-1-[(E,2R,6R)-6-[tert-butyl(dimethyl)silyl]oxyhept-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] benzoate.
| Compound Name | [(1R,3aR,4S,7aR)-1-[(E,2R,6R)-6-[tert-butyl(dimethyl)silyl]oxyhept-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] benzoate |
|---|---|
| PubChem CID | 59142183 |
| Molecular Formula | C30H48O3Si |
| Molecular Weight | 484.80 g/mol |
| Exact Mass | 484.34 |
| IUPAC Name | [(1R,3aR,4S,7aR)-1-[(E,2R,6R)-6-[tert-butyl(dimethyl)silyl]oxyhept-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] benzoate |
| SMILES | C[C@H](C/C=C/[C@@H](C)[C@H]1CC[C@H]2[C@@H](OC(=O)c3ccccc3)CCC[C@]12C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H48O3Si/c1-22(14-12-15-23(2)33-34(7,8)29(3,4)5)25-19-20-26-27(18-13-21-30(25,26)6)32-28(31)24-16-10-9-11-17-24/h9-12,14,16-17,22-23,25-27H,13,15,18-21H2,1-8H3/b14-12+/t22-,23-,25-,26+,27+,30-/m1/s1 |
| InChIKey | PWJFLQLNCAIJQI-AMKTXHQISA-N |
| XLogP | 8.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.80 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|