C28H56O2Si2 — CID 68935718
[(3R,6R)-6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,3-dimethylhept-4-en-2-yl]oxy-trimethylsilane (PubChem CID 68935718) has the molecular formula C28H56O2Si2 and a molecular weight of 480.93 g/mol. Its IUPAC name is [(3R,6R)-6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,3-dimethylhept-4-en-2-yl]oxy-trimethylsilane.
| Compound Name | [(3R,6R)-6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,3-dimethylhept-4-en-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 68935718 |
| Molecular Formula | C28H56O2Si2 |
| Molecular Weight | 480.93 g/mol |
| Exact Mass | 480.38 |
| IUPAC Name | [(3R,6R)-6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2,3-dimethylhept-4-en-2-yl]oxy-trimethylsilane |
| SMILES | C[C@H](C=C[C@@H](C)C(C)(C)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C28H56O2Si2/c1-21(16-17-22(2)27(6,7)30-31(9,10)11)23-18-19-24-25(15-14-20-28(23,24)8)29-32(12,13)26(3,4)5/h16-17,21-25H,14-15,18-20H2,1-13H3/t21-,22-,23-,24+,25+,28-/m1/s1 |
| InChIKey | OXERWIKWMIRUCE-BRMWOSQNSA-N |
| XLogP | 9.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.93 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|