C27H42O3 — CID 118730482
[(1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] 3-(4-hydroxyphenyl)propanoate (PubChem CID 118730482) has the molecular formula C27H42O3 and a molecular weight of 414.63 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] 3-(4-hydroxyphenyl)propanoate.
| Compound Name | [(1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] 3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 118730482 |
| Molecular Formula | C27H42O3 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | [(1R,3aR,4S,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl] 3-(4-hydroxyphenyl)propanoate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H](OC(=O)CCc3ccc(O)cc3)CCC[C@]12C |
| InChI | InChI=1S/C27H42O3/c1-19(2)7-5-8-20(3)23-15-16-24-25(9-6-18-27(23,24)4)30-26(29)17-12-21-10-13-22(28)14-11-21/h10-11,13-14,19-20,23-25,28H,5-9,12,15-18H2,1-4H3/t20-,23-,24+,25+,27-/m1/s1 |
| InChIKey | JARYQZBMLAYQQI-RWDSZGCBSA-N |
| XLogP | 6.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |