C42H57NO6Si — CID 139262776
benzyl N-[(1S,2R)-2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-1-[(E)-7-(methoxymethoxy)-4-oxohept-2-enyl]cyclopentyl]carbamate (PubChem CID 139262776) has the molecular formula C42H57NO6Si and a molecular weight of 700.01 g/mol. Its IUPAC name is benzyl N-[(1S,2R)-2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-1-[(E)-7-(methoxymethoxy)-4-oxohept-2-enyl]cyclopentyl]carbamate.
| Compound Name | benzyl N-[(1S,2R)-2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-1-[(E)-7-(methoxymethoxy)-4-oxohept-2-enyl]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 139262776 |
| Molecular Formula | C42H57NO6Si |
| Molecular Weight | 700.01 g/mol |
| Exact Mass | 699.40 |
| IUPAC Name | benzyl N-[(1S,2R)-2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-1-[(E)-7-(methoxymethoxy)-4-oxohept-2-enyl]cyclopentyl]carbamate |
| SMILES | COCOCCCC(=O)/C=C/C[C@@]1(NC(=O)OCc2ccccc2)CCC[C@@H]1[C@@H](C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C42H57NO6Si/c1-34(27-31-49-50(41(2,3)4,37-22-11-7-12-23-37)38-24-13-8-14-25-38)39-26-16-29-42(39,28-15-20-36(44)21-17-30-47-33-46-5)43-40(45)48-32-35-18-9-6-10-19-35/h6-15,18-20,22-25,34,39H,16-17,21,26-33H2,1-5H3,(H,43,45)/b20-15+/t34-,39+,42+/m0/s1 |
| InChIKey | XSEKLBCAWBUFJL-ILMUOGIWSA-N |
| XLogP | 7.97 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.01 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|