C40H53NO6Si — CID 11700328
(2S,5S)-2-[(3R)-6-[tert-butyl(diphenyl)silyl]oxyhex-1-en-3-yl]-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(phenylmethoxymethyl)pyrrolidine-2-carboxylic acid (PubChem CID 11700328) has the molecular formula C40H53NO6Si and a molecular weight of 671.95 g/mol. Its IUPAC name is (2S,5S)-2-[(3R)-6-[tert-butyl(diphenyl)silyl]oxyhex-1-en-3-yl]-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(phenylmethoxymethyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,5S)-2-[(3R)-6-[tert-butyl(diphenyl)silyl]oxyhex-1-en-3-yl]-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(phenylmethoxymethyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 11700328 |
| Molecular Formula | C40H53NO6Si |
| Molecular Weight | 671.95 g/mol |
| Exact Mass | 671.36 |
| IUPAC Name | (2S,5S)-2-[(3R)-6-[tert-butyl(diphenyl)silyl]oxyhex-1-en-3-yl]-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-(phenylmethoxymethyl)pyrrolidine-2-carboxylic acid |
| SMILES | C=C[C@@H](CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@]1(C(=O)O)CC[C@@H](COCc2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C40H53NO6Si/c1-8-32(21-18-28-46-48(39(5,6)7,34-22-14-10-15-23-34)35-24-16-11-17-25-35)40(36(42)43)27-26-33(41(40)37(44)47-38(2,3)4)30-45-29-31-19-12-9-13-20-31/h8-17,19-20,22-25,32-33H,1,18,21,26-30H2,2-7H3,(H,42,43)/t32-,33-,40-/m0/s1 |
| InChIKey | ROLCPDKETFENJL-REDUTEOISA-N |
| XLogP | 7.59 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.95 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|