C40H57NO7Si — CID 46209836
tert-butyl (3S,4R,5R)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-hydroxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine-1-carboxylate (PubChem CID 46209836) has the molecular formula C40H57NO7Si and a molecular weight of 691.98 g/mol. Its IUPAC name is tert-butyl (3S,4R,5R)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-hydroxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R,5R)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-hydroxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 46209836 |
| Molecular Formula | C40H57NO7Si |
| Molecular Weight | 691.98 g/mol |
| Exact Mass | 691.39 |
| IUPAC Name | tert-butyl (3S,4R,5R)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-2-hydroxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1(O)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C40H57NO7Si/c1-38(2,3)48-37(42)41-34(30-44-27-31-19-12-9-13-20-31)35(45-28-32-21-14-10-15-22-32)36(46-29-33-23-16-11-17-24-33)40(41,43)25-18-26-47-49(7,8)39(4,5)6/h9-17,19-24,34-36,43H,18,25-30H2,1-8H3/t34-,35-,36+,40?/m1/s1 |
| InChIKey | QLHAUAXBOYYOAA-IBDQCILHSA-N |
| XLogP | 8.48 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.98 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|