C46H67NO6Si2 — CID 134939418
1-O-tert-butyl 2-O-[tert-butyl(dimethyl)silyl] (2S,5S)-2-[(3R)-6-[tert-butyl(diphenyl)silyl]oxyhex-1-en-3-yl]-5-(phenylmethoxymethyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 134939418) has the molecular formula C46H67NO6Si2 and a molecular weight of 786.22 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-[tert-butyl(dimethyl)silyl] (2S,5S)-2-[(3R)-6-[tert-butyl(diphenyl)silyl]oxyhex-1-en-3-yl]-5-(phenylmethoxymethyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-[tert-butyl(dimethyl)silyl] (2S,5S)-2-[(3R)-6-[tert-butyl(diphenyl)silyl]oxyhex-1-en-3-yl]-5-(phenylmethoxymethyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134939418 |
| Molecular Formula | C46H67NO6Si2 |
| Molecular Weight | 786.22 g/mol |
| Exact Mass | 785.45 |
| IUPAC Name | 1-O-tert-butyl 2-O-[tert-butyl(dimethyl)silyl] (2S,5S)-2-[(3R)-6-[tert-butyl(diphenyl)silyl]oxyhex-1-en-3-yl]-5-(phenylmethoxymethyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | C=C[C@@H](CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@]1(C(=O)O[Si](C)(C)C(C)(C)C)CC[C@@H](COCc2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C46H67NO6Si2/c1-13-37(26-23-33-51-55(45(8,9)10,39-27-19-15-20-28-39)40-29-21-16-22-30-40)46(41(48)53-54(11,12)44(5,6)7)32-31-38(47(46)42(49)52-43(2,3)4)35-50-34-36-24-17-14-18-25-36/h13-22,24-25,27-30,37-38H,1,23,26,31-35H2,2-12H3/t37-,38-,46-/m0/s1 |
| InChIKey | HBEALRNRUWBQAZ-CHJMVYJFSA-N |
| XLogP | 10.05 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.22 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|