C31H49NO4 — CID 11443411
tert-butyl (2S,5S,6S)-6-[(E,3S)-3-hydroxynon-1-enyl]-2-(phenylmethoxymethyl)-1-azaspiro[4.5]decane-1-carboxylate (PubChem CID 11443411) has the molecular formula C31H49NO4 and a molecular weight of 499.74 g/mol. Its IUPAC name is tert-butyl (2S,5S,6S)-6-[(E,3S)-3-hydroxynon-1-enyl]-2-(phenylmethoxymethyl)-1-azaspiro[4.5]decane-1-carboxylate.
| Compound Name | tert-butyl (2S,5S,6S)-6-[(E,3S)-3-hydroxynon-1-enyl]-2-(phenylmethoxymethyl)-1-azaspiro[4.5]decane-1-carboxylate |
|---|---|
| PubChem CID | 11443411 |
| Molecular Formula | C31H49NO4 |
| Molecular Weight | 499.74 g/mol |
| Exact Mass | 499.37 |
| IUPAC Name | tert-butyl (2S,5S,6S)-6-[(E,3S)-3-hydroxynon-1-enyl]-2-(phenylmethoxymethyl)-1-azaspiro[4.5]decane-1-carboxylate |
| SMILES | CCCCCC[C@H](O)/C=C/[C@@H]1CCCC[C@]12CC[C@@H](COCc1ccccc1)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H49NO4/c1-5-6-7-11-17-28(33)19-18-26-16-12-13-21-31(26)22-20-27(32(31)29(34)36-30(2,3)4)24-35-23-25-14-9-8-10-15-25/h8-10,14-15,18-19,26-28,33H,5-7,11-13,16-17,20-24H2,1-4H3/b19-18+/t26-,27-,28-,31-/m0/s1 |
| InChIKey | YWWBYMFTNLVBNN-AWJXFMBZSA-N |
| XLogP | 7.42 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.74 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|