C26H41NO — CID 10572055
(3R,5S,7aS,11aR)-5-hexyl-3-(phenylmethoxymethyl)-2,3,5,6,7,7a,8,9,10,11-decahydro-1H-pyrrolo[2,1-j]quinoline (PubChem CID 10572055) has the molecular formula C26H41NO and a molecular weight of 383.62 g/mol. Its IUPAC name is (3R,5S,7aS,11aR)-5-hexyl-3-(phenylmethoxymethyl)-2,3,5,6,7,7a,8,9,10,11-decahydro-1H-pyrrolo[2,1-j]quinoline.
| Compound Name | (3R,5S,7aS,11aR)-5-hexyl-3-(phenylmethoxymethyl)-2,3,5,6,7,7a,8,9,10,11-decahydro-1H-pyrrolo[2,1-j]quinoline |
|---|---|
| PubChem CID | 10572055 |
| Molecular Formula | C26H41NO |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 383.32 |
| IUPAC Name | (3R,5S,7aS,11aR)-5-hexyl-3-(phenylmethoxymethyl)-2,3,5,6,7,7a,8,9,10,11-decahydro-1H-pyrrolo[2,1-j]quinoline |
| SMILES | CCCCCC[C@H]1CC[C@@H]2CCCC[C@@]23CC[C@H](COCc2ccccc2)N13 |
| InChI | InChI=1S/C26H41NO/c1-2-3-4-8-14-24-16-15-23-13-9-10-18-26(23)19-17-25(27(24)26)21-28-20-22-11-6-5-7-12-22/h5-7,11-12,23-25H,2-4,8-10,13-21H2,1H3/t23-,24-,25+,26+/m0/s1 |
| InChIKey | OUOLNCUGALIINT-QEGGNFSNSA-N |
| XLogP | 6.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|