C35H53NO2Si — CID 16719799
(3S,5R,7S,7aR,11aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hexyl-2,3,5,6,7,7a,8,9,10,11-decahydro-1H-pyrrolo[2,1-j]quinolin-7-ol (PubChem CID 16719799) has the molecular formula C35H53NO2Si and a molecular weight of 547.90 g/mol. Its IUPAC name is (3S,5R,7S,7aR,11aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hexyl-2,3,5,6,7,7a,8,9,10,11-decahydro-1H-pyrrolo[2,1-j]quinolin-7-ol.
| Compound Name | (3S,5R,7S,7aR,11aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hexyl-2,3,5,6,7,7a,8,9,10,11-decahydro-1H-pyrrolo[2,1-j]quinolin-7-ol |
|---|---|
| PubChem CID | 16719799 |
| Molecular Formula | C35H53NO2Si |
| Molecular Weight | 547.90 g/mol |
| Exact Mass | 547.38 |
| IUPAC Name | (3S,5R,7S,7aR,11aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-hexyl-2,3,5,6,7,7a,8,9,10,11-decahydro-1H-pyrrolo[2,1-j]quinolin-7-ol |
| SMILES | CCCCCC[C@@H]1C[C@H](O)[C@@H]2CCCC[C@]23CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N13 |
| InChI | InChI=1S/C35H53NO2Si/c1-5-6-7-10-17-28-26-33(37)32-22-15-16-24-35(32)25-23-29(36(28)35)27-38-39(34(2,3)4,30-18-11-8-12-19-30)31-20-13-9-14-21-31/h8-9,11-14,18-21,28-29,32-33,37H,5-7,10,15-17,22-27H2,1-4H3/t28-,29+,32+,33+,35+/m1/s1 |
| InChIKey | SUBINHRBCKJJND-LSTGJQQTSA-N |
| XLogP | 7.06 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.90 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|