C28H40O4Si — CID 154446767
(3R,4R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hexyl-4-hydroxy-5-methyloxolan-2-one (PubChem CID 154446767) has the molecular formula C28H40O4Si and a molecular weight of 468.71 g/mol. Its IUPAC name is (3R,4R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hexyl-4-hydroxy-5-methyloxolan-2-one.
| Compound Name | (3R,4R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hexyl-4-hydroxy-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 154446767 |
| Molecular Formula | C28H40O4Si |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | (3R,4R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hexyl-4-hydroxy-5-methyloxolan-2-one |
| SMILES | CCCCCC[C@H]1C(=O)OC(C)(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C28H40O4Si/c1-6-7-8-15-20-24-25(29)28(5,32-26(24)30)21-31-33(27(2,3)4,22-16-11-9-12-17-22)23-18-13-10-14-19-23/h9-14,16-19,24-25,29H,6-8,15,20-21H2,1-5H3/t24-,25-,28?/m1/s1 |
| InChIKey | BWACBQSLVURLBV-RCUHSBBRSA-N |
| XLogP | 4.83 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|