C40H60O3Si — CID 140827410
3-[4-(4-pentylcyclohexyl)cyclohexyl]propyl 2-[[tert-butyl(diphenyl)silyl]oxymethyl]prop-2-enoate (PubChem CID 140827410) has the molecular formula C40H60O3Si and a molecular weight of 617.00 g/mol. Its IUPAC name is 3-[4-(4-pentylcyclohexyl)cyclohexyl]propyl 2-[[tert-butyl(diphenyl)silyl]oxymethyl]prop-2-enoate.
| Compound Name | 3-[4-(4-pentylcyclohexyl)cyclohexyl]propyl 2-[[tert-butyl(diphenyl)silyl]oxymethyl]prop-2-enoate |
|---|---|
| PubChem CID | 140827410 |
| Molecular Formula | C40H60O3Si |
| Molecular Weight | 617.00 g/mol |
| Exact Mass | 616.43 |
| IUPAC Name | 3-[4-(4-pentylcyclohexyl)cyclohexyl]propyl 2-[[tert-butyl(diphenyl)silyl]oxymethyl]prop-2-enoate |
| SMILES | C=C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)OCCCC1CCC(C2CCC(CCCCC)CC2)CC1 |
| InChI | InChI=1S/C40H60O3Si/c1-6-7-10-16-33-22-26-35(27-23-33)36-28-24-34(25-29-36)17-15-30-42-39(41)32(2)31-43-44(40(3,4)5,37-18-11-8-12-19-37)38-20-13-9-14-21-38/h8-9,11-14,18-21,33-36H,2,6-7,10,15-17,22-31H2,1,3-5H3 |
| InChIKey | IPASECNJJDUWFJ-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.00 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|