C26H37NO3Si — CID 175819406
butyl (3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 175819406) has the molecular formula C26H37NO3Si and a molecular weight of 439.67 g/mol. Its IUPAC name is butyl (3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | butyl (3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175819406 |
| Molecular Formula | C26H37NO3Si |
| Molecular Weight | 439.67 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | butyl (3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C26H37NO3Si/c1-5-6-19-29-25(28)27-18-17-22(20-27)21-30-31(26(2,3)4,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-16,22H,5-6,17-21H2,1-4H3/t22-/m1/s1 |
| InChIKey | MYZYCYYVWBTOQA-JOCHJYFZSA-N |
| XLogP | 4.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.67 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|