C22H28O5Si — CID 67792078
[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-2-yl] acetate (PubChem CID 67792078) has the molecular formula C22H28O5Si and a molecular weight of 400.55 g/mol. Its IUPAC name is [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-2-yl] acetate.
| Compound Name | [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-2-yl] acetate |
|---|---|
| PubChem CID | 67792078 |
| Molecular Formula | C22H28O5Si |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-dioxolan-2-yl] acetate |
| SMILES | CC(=O)OC1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OCCO1 |
| InChI | InChI=1S/C22H28O5Si/c1-18(23)27-22(24-15-16-25-22)17-26-28(21(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14H,15-17H2,1-4H3 |
| InChIKey | MOMNNDQHMAKZRP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|