C27H36O3Si — CID 142526845
methyl 4-[[tert-butyl(diphenyl)silyl]oxymethyl]bicyclo[2.2.2]octane-1-carboxylate (PubChem CID 142526845) has the molecular formula C27H36O3Si and a molecular weight of 436.67 g/mol. Its IUPAC name is methyl 4-[[tert-butyl(diphenyl)silyl]oxymethyl]bicyclo[2.2.2]octane-1-carboxylate.
| Compound Name | methyl 4-[[tert-butyl(diphenyl)silyl]oxymethyl]bicyclo[2.2.2]octane-1-carboxylate |
|---|---|
| PubChem CID | 142526845 |
| Molecular Formula | C27H36O3Si |
| Molecular Weight | 436.67 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | methyl 4-[[tert-butyl(diphenyl)silyl]oxymethyl]bicyclo[2.2.2]octane-1-carboxylate |
| SMILES | COC(=O)C12CCC(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)(CC1)CC2 |
| InChI | InChI=1S/C27H36O3Si/c1-25(2,3)31(22-11-7-5-8-12-22,23-13-9-6-10-14-23)30-21-26-15-18-27(19-16-26,20-17-26)24(28)29-4/h5-14H,15-21H2,1-4H3 |
| InChIKey | GMKQAUQYLLIHOS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.67 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|