C27H36O3Si — CID 102593768
methyl (1R,2R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dimethylcyclohex-3-ene-1-carboxylate (PubChem CID 102593768) has the molecular formula C27H36O3Si and a molecular weight of 436.67 g/mol. Its IUPAC name is methyl (1R,2R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dimethylcyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,2R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dimethylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 102593768 |
| Molecular Formula | C27H36O3Si |
| Molecular Weight | 436.67 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | methyl (1R,2R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dimethylcyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)=C[C@H]1C |
| InChI | InChI=1S/C27H36O3Si/c1-21-19-22(17-18-27(21,5)25(28)29-6)20-30-31(26(2,3)4,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-16,19,21H,17-18,20H2,1-6H3/t21-,27-/m1/s1 |
| InChIKey | YOEIKCYINYCOPP-JIPXPUAJSA-N |
| XLogP | 5.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|