C26H34O2Si — CID 102593766
(1R,2R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dimethylcyclohex-3-ene-1-carbaldehyde (PubChem CID 102593766) has the molecular formula C26H34O2Si and a molecular weight of 406.64 g/mol. Its IUPAC name is (1R,2R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dimethylcyclohex-3-ene-1-carbaldehyde.
| Compound Name | (1R,2R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dimethylcyclohex-3-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 102593766 |
| Molecular Formula | C26H34O2Si |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | (1R,2R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2-dimethylcyclohex-3-ene-1-carbaldehyde |
| SMILES | C[C@@H]1C=C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC[C@@]1(C)C=O |
| InChI | InChI=1S/C26H34O2Si/c1-21-18-22(16-17-26(21,5)20-27)19-28-29(25(2,3)4,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-15,18,20-21H,16-17,19H2,1-5H3/t21-,26+/m1/s1 |
| InChIKey | JIZIOFNCBLHKIS-RLWLMLJZSA-N |
| XLogP | 5.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|