C29H38O2Si — CID 134923080
(3aR,4R,5S,7aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,7a-dimethyl-1,2,3,3a,4,5-hexahydroindene-4-carbaldehyde (PubChem CID 134923080) has the molecular formula C29H38O2Si and a molecular weight of 446.71 g/mol. Its IUPAC name is (3aR,4R,5S,7aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,7a-dimethyl-1,2,3,3a,4,5-hexahydroindene-4-carbaldehyde.
| Compound Name | (3aR,4R,5S,7aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,7a-dimethyl-1,2,3,3a,4,5-hexahydroindene-4-carbaldehyde |
|---|---|
| PubChem CID | 134923080 |
| Molecular Formula | C29H38O2Si |
| Molecular Weight | 446.71 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | (3aR,4R,5S,7aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,7a-dimethyl-1,2,3,3a,4,5-hexahydroindene-4-carbaldehyde |
| SMILES | C[C@@H]1C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)=C[C@]2(C)CCC[C@@H]2[C@@H]1C=O |
| InChI | InChI=1S/C29H38O2Si/c1-22-23(19-29(5)18-12-17-27(29)26(22)20-30)21-31-32(28(2,3)4,24-13-8-6-9-14-24)25-15-10-7-11-16-25/h6-11,13-16,19-20,22,26-27H,12,17-18,21H2,1-5H3/t22-,26-,27-,29+/m1/s1 |
| InChIKey | XASROKWPXPPDAK-VXLFPREFSA-N |
| XLogP | 5.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.71 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|