C30H42O2Si — CID 11634036
(E,4S)-4-[(1R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,2-trimethylcyclopentyl]pent-2-enal (PubChem CID 11634036) has the molecular formula C30H42O2Si and a molecular weight of 462.75 g/mol. Its IUPAC name is (E,4S)-4-[(1R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,2-trimethylcyclopentyl]pent-2-enal.
| Compound Name | (E,4S)-4-[(1R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,2-trimethylcyclopentyl]pent-2-enal |
|---|---|
| PubChem CID | 11634036 |
| Molecular Formula | C30H42O2Si |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | (E,4S)-4-[(1R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,2-trimethylcyclopentyl]pent-2-enal |
| SMILES | C[C@@H](/C=C/C=O)[C@@]1(C)CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C30H42O2Si/c1-24(15-14-22-31)30(7)21-20-25(29(30,5)6)23-32-33(28(2,3)4,26-16-10-8-11-17-26)27-18-12-9-13-19-27/h8-19,22,24-25H,20-21,23H2,1-7H3/b15-14+/t24-,25-,30+/m0/s1 |
| InChIKey | NQNLKFWEDIMVIG-LQCFGOCGSA-N |
| XLogP | 6.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|