C28H38O4Si — CID 11751686
(2R)-2-[(1R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methylcyclohex-3-en-1-yl]-2-(methoxymethoxy)acetaldehyde (PubChem CID 11751686) has the molecular formula C28H38O4Si and a molecular weight of 466.69 g/mol. Its IUPAC name is (2R)-2-[(1R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methylcyclohex-3-en-1-yl]-2-(methoxymethoxy)acetaldehyde.
| Compound Name | (2R)-2-[(1R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methylcyclohex-3-en-1-yl]-2-(methoxymethoxy)acetaldehyde |
|---|---|
| PubChem CID | 11751686 |
| Molecular Formula | C28H38O4Si |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | (2R)-2-[(1R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methylcyclohex-3-en-1-yl]-2-(methoxymethoxy)acetaldehyde |
| SMILES | COCO[C@@H](C=O)[C@]1(C)CC=CC[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H38O4Si/c1-27(2,3)33(24-15-8-6-9-16-24,25-17-10-7-11-18-25)32-21-23-14-12-13-19-28(23,4)26(20-29)31-22-30-5/h6-13,15-18,20,23,26H,14,19,21-22H2,1-5H3/t23-,26-,28+/m0/s1 |
| InChIKey | VZNMNLSNGIJINV-PAUTXSKSSA-N |
| XLogP | 4.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|