C31H41NO5Si — CID 72793402
(2S,3S)-N-benzyl-4-[tert-butyl(diphenyl)silyl]oxy-2,3-bis(methoxymethoxy)butan-1-imine (PubChem CID 72793402) has the molecular formula C31H41NO5Si and a molecular weight of 535.76 g/mol. Its IUPAC name is (2S,3S)-N-benzyl-4-[tert-butyl(diphenyl)silyl]oxy-2,3-bis(methoxymethoxy)butan-1-imine.
| Compound Name | (2S,3S)-N-benzyl-4-[tert-butyl(diphenyl)silyl]oxy-2,3-bis(methoxymethoxy)butan-1-imine |
|---|---|
| PubChem CID | 72793402 |
| Molecular Formula | C31H41NO5Si |
| Molecular Weight | 535.76 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | (2S,3S)-N-benzyl-4-[tert-butyl(diphenyl)silyl]oxy-2,3-bis(methoxymethoxy)butan-1-imine |
| SMILES | COCO[C@@H](/C=N/Cc1ccccc1)[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCOC |
| InChI | InChI=1S/C31H41NO5Si/c1-31(2,3)38(27-17-11-7-12-18-27,28-19-13-8-14-20-28)37-23-30(36-25-34-5)29(35-24-33-4)22-32-21-26-15-9-6-10-16-26/h6-20,22,29-30H,21,23-25H2,1-5H3/b32-22+/t29-,30-/m0/s1 |
| InChIKey | JAXWALJLUPEJPZ-PNZJSVPPSA-N |
| XLogP | 4.81 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.76 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|